C15H29NO2Si2 — CID 530100
2-(3-methoxy-4-trimethylsilyloxyphenyl)-N-trimethylsilylethanamine (PubChem CID 530100) has the molecular formula C15H29NO2Si2 and a molecular weight of 311.57 g/mol. Its IUPAC name is 2-(3-methoxy-4-trimethylsilyloxyphenyl)-N-trimethylsilylethanamine.
| Compound Name | 2-(3-methoxy-4-trimethylsilyloxyphenyl)-N-trimethylsilylethanamine |
|---|---|
| PubChem CID | 530100 |
| Molecular Formula | C15H29NO2Si2 |
| Molecular Weight | 311.57 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-(3-methoxy-4-trimethylsilyloxyphenyl)-N-trimethylsilylethanamine |
| SMILES | COc1cc(CCN[Si](C)(C)C)ccc1O[Si](C)(C)C |
| InChI | InChI=1S/C15H29NO2Si2/c1-17-15-12-13(10-11-16-19(2,3)4)8-9-14(15)18-20(5,6)7/h8-9,12,16H,10-11H2,1-7H3 |
| InChIKey | ZKOVGXLZJCJXIS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|