C14H20F3NO3Si — CID 553439
2,2,2-trifluoro-N-[2-(3-methoxy-4-trimethylsilyloxyphenyl)ethyl]acetamide (PubChem CID 553439) has the molecular formula C14H20F3NO3Si and a molecular weight of 335.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(3-methoxy-4-trimethylsilyloxyphenyl)ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-(3-methoxy-4-trimethylsilyloxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 553439 |
| Molecular Formula | C14H20F3NO3Si |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(3-methoxy-4-trimethylsilyloxyphenyl)ethyl]acetamide |
| SMILES | COc1cc(CCNC(=O)C(F)(F)F)ccc1O[Si](C)(C)C |
| InChI | InChI=1S/C14H20F3NO3Si/c1-20-12-9-10(5-6-11(12)21-22(2,3)4)7-8-18-13(19)14(15,16)17/h5-6,9H,7-8H2,1-4H3,(H,18,19) |
| InChIKey | AAOKGRKMDRTZJG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|