C18H19F3N2O2 — CID 21282392
N-[2-[3-(benzylamino)-4-methoxyphenyl]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 21282392) has the molecular formula C18H19F3N2O2 and a molecular weight of 352.36 g/mol. Its IUPAC name is N-[2-[3-(benzylamino)-4-methoxyphenyl]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[3-(benzylamino)-4-methoxyphenyl]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 21282392 |
| Molecular Formula | C18H19F3N2O2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[2-[3-(benzylamino)-4-methoxyphenyl]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccc(CCNC(=O)C(F)(F)F)cc1NCc1ccccc1 |
| InChI | InChI=1S/C18H19F3N2O2/c1-25-16-8-7-13(9-10-22-17(24)18(19,20)21)11-15(16)23-12-14-5-3-2-4-6-14/h2-8,11,23H,9-10,12H2,1H3,(H,22,24) |
| InChIKey | IUURLXOWKVEWAB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |