C14H12F3NO — CID 19963458
2,2,2-trifluoro-N-(2-naphthalen-2-ylethyl)acetamide (PubChem CID 19963458) has the molecular formula C14H12F3NO and a molecular weight of 267.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2-naphthalen-2-ylethyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(2-naphthalen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 19963458 |
| Molecular Formula | C14H12F3NO |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2,2,2-trifluoro-N-(2-naphthalen-2-ylethyl)acetamide |
| SMILES | O=C(NCCc1ccc2ccccc2c1)C(F)(F)F |
| InChI | InChI=1S/C14H12F3NO/c15-14(16,17)13(19)18-8-7-10-5-6-11-3-1-2-4-12(11)9-10/h1-6,9H,7-8H2,(H,18,19) |
| InChIKey | MXIOVGQZWVFLCR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |