C23H24N2O3 — CID 67871942
[2-methyl-3-naphthalen-2-yl-1-oxo-1-(2-phenylethylamino)propan-2-yl] carbamate (PubChem CID 67871942) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is [2-methyl-3-naphthalen-2-yl-1-oxo-1-(2-phenylethylamino)propan-2-yl] carbamate.
| Compound Name | [2-methyl-3-naphthalen-2-yl-1-oxo-1-(2-phenylethylamino)propan-2-yl] carbamate |
|---|---|
| PubChem CID | 67871942 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | [2-methyl-3-naphthalen-2-yl-1-oxo-1-(2-phenylethylamino)propan-2-yl] carbamate |
| SMILES | CC(Cc1ccc2ccccc2c1)(OC(N)=O)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C23H24N2O3/c1-23(28-22(24)27,21(26)25-14-13-17-7-3-2-4-8-17)16-18-11-12-19-9-5-6-10-20(19)15-18/h2-12,15H,13-14,16H2,1H3,(H2,24,27)(H,25,26) |
| InChIKey | GDRAGYYQDIAPSQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |