C10H11F3N2O — CID 58723639
N-[2-(3-aminophenyl)ethyl]-2,2,2-trifluoroacetamide (PubChem CID 58723639) has the molecular formula C10H11F3N2O and a molecular weight of 232.21 g/mol. Its IUPAC name is N-[2-(3-aminophenyl)ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(3-aminophenyl)ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 58723639 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N-[2-(3-aminophenyl)ethyl]-2,2,2-trifluoroacetamide |
| SMILES | Nc1cccc(CCNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F3N2O/c11-10(12,13)9(16)15-5-4-7-2-1-3-8(14)6-7/h1-3,6H,4-5,14H2,(H,15,16) |
| InChIKey | SJEAKJXSLFMYNF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|