C10H12ClF3N2O — CID 86611680
N-[2-(3-aminophenyl)ethyl]-2,2,2-trifluoroacetamide;hydrochloride (PubChem CID 86611680) has the molecular formula C10H12ClF3N2O and a molecular weight of 268.67 g/mol. Its IUPAC name is N-[2-(3-aminophenyl)ethyl]-2,2,2-trifluoroacetamide;hydrochloride.
| Compound Name | N-[2-(3-aminophenyl)ethyl]-2,2,2-trifluoroacetamide;hydrochloride |
|---|---|
| PubChem CID | 86611680 |
| Molecular Formula | C10H12ClF3N2O |
| Molecular Weight | 268.67 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | N-[2-(3-aminophenyl)ethyl]-2,2,2-trifluoroacetamide;hydrochloride |
| SMILES | Cl.Nc1cccc(CCNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F3N2O.ClH/c11-10(12,13)9(16)15-5-4-7-2-1-3-8(14)6-7;/h1-3,6H,4-5,14H2,(H,15,16);1H |
| InChIKey | UJIILMDWGHDKFB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.67 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|