C11H10ClF4NO — CID 103732092
N-[2-(3-chlorophenyl)ethyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103732092) has the molecular formula C11H10ClF4NO and a molecular weight of 283.65 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103732092 |
| Molecular Formula | C11H10ClF4NO |
| Molecular Weight | 283.65 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(NCCc1cccc(Cl)c1)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H10ClF4NO/c12-8-3-1-2-7(6-8)4-5-17-10(18)11(15,16)9(13)14/h1-3,6,9H,4-5H2,(H,17,18) |
| InChIKey | ATTWBLVCIVDOKV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.65 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|