C12H12ClF3N2O2 — CID 108932591
N-[2-[[2-(3-chlorophenyl)acetyl]amino]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 108932591) has the molecular formula C12H12ClF3N2O2 and a molecular weight of 308.69 g/mol. Its IUPAC name is N-[2-[[2-(3-chlorophenyl)acetyl]amino]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[[2-(3-chlorophenyl)acetyl]amino]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 108932591 |
| Molecular Formula | C12H12ClF3N2O2 |
| Molecular Weight | 308.69 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | N-[2-[[2-(3-chlorophenyl)acetyl]amino]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Cc1cccc(Cl)c1)NCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H12ClF3N2O2/c13-9-3-1-2-8(6-9)7-10(19)17-4-5-18-11(20)12(14,15)16/h1-3,6H,4-5,7H2,(H,17,19)(H,18,20) |
| InChIKey | IGUGTDQYCWSVRJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.69 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|