C11H15ClN2O3S — CID 62505682
2-(3-chlorophenyl)-N-(3-sulfamoylpropyl)acetamide (PubChem CID 62505682) has the molecular formula C11H15ClN2O3S and a molecular weight of 290.77 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-(3-sulfamoylpropyl)acetamide.
| Compound Name | 2-(3-chlorophenyl)-N-(3-sulfamoylpropyl)acetamide |
|---|---|
| PubChem CID | 62505682 |
| Molecular Formula | C11H15ClN2O3S |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-(3-chlorophenyl)-N-(3-sulfamoylpropyl)acetamide |
| SMILES | NS(=O)(=O)CCCNC(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2O3S/c12-10-4-1-3-9(7-10)8-11(15)14-5-2-6-18(13,16)17/h1,3-4,7H,2,5-6,8H2,(H,14,15)(H2,13,16,17) |
| InChIKey | CALDQLYDUWDDNA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|