C14H22ClN2O3S+ — CID 4139237
2-[3-[(3-chlorophenyl)methylsulfonyl]propanoylamino]ethyl-dimethylazanium (PubChem CID 4139237) has the molecular formula C14H22ClN2O3S+ and a molecular weight of 333.86 g/mol. Its IUPAC name is 2-[3-[(3-chlorophenyl)methylsulfonyl]propanoylamino]ethyl-dimethylazanium.
| Compound Name | 2-[3-[(3-chlorophenyl)methylsulfonyl]propanoylamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 4139237 |
| Molecular Formula | C14H22ClN2O3S+ |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-[3-[(3-chlorophenyl)methylsulfonyl]propanoylamino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=O)CCS(=O)(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H21ClN2O3S/c1-17(2)8-7-16-14(18)6-9-21(19,20)11-12-4-3-5-13(15)10-12/h3-5,10H,6-9,11H2,1-2H3,(H,16,18)/p+1 |
| InChIKey | RGOTUDKPXKKOME-UHFFFAOYSA-O |
| XLogP | -0.09 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |