C13H18ClNO3S — CID 47155845
N-butyl-2-[(3-chlorophenyl)methylsulfonyl]acetamide (PubChem CID 47155845) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is N-butyl-2-[(3-chlorophenyl)methylsulfonyl]acetamide.
| Compound Name | N-butyl-2-[(3-chlorophenyl)methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 47155845 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-butyl-2-[(3-chlorophenyl)methylsulfonyl]acetamide |
| SMILES | CCCCNC(=O)CS(=O)(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClNO3S/c1-2-3-7-15-13(16)10-19(17,18)9-11-5-4-6-12(14)8-11/h4-6,8H,2-3,7,9-10H2,1H3,(H,15,16) |
| InChIKey | YZAHTEDFHNSFSI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|