C15H17ClN2O — CID 110721086
2-(3-chlorophenyl)-N-(3-pyrrol-1-ylpropyl)acetamide (PubChem CID 110721086) has the molecular formula C15H17ClN2O and a molecular weight of 276.76 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-(3-pyrrol-1-ylpropyl)acetamide.
| Compound Name | 2-(3-chlorophenyl)-N-(3-pyrrol-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 110721086 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(3-chlorophenyl)-N-(3-pyrrol-1-ylpropyl)acetamide |
| SMILES | C1=CN(C=C1)CCCNC(=O)CC2=CC(=CC=C2)Cl |
| InChI | InChI=1S/C15H17ClN2O/c16-14-6-3-5-13(11-14)12-15(19)17-7-4-10-18-8-1-2-9-18/h1-3,5-6,8-9,11H,4,7,10,12H2,(H,17,19) |
| InChIKey | CQXZXVUWGKKEEV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 34.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | 279 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|