C9H6ClF3O — CID 15113984
3-(3-chlorophenyl)-1,1,1-trifluoropropan-2-one (PubChem CID 15113984) has the molecular formula C9H6ClF3O and a molecular weight of 222.59 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1,1,1-trifluoropropan-2-one.
| Compound Name | 3-(3-chlorophenyl)-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 15113984 |
| Molecular Formula | C9H6ClF3O |
| Molecular Weight | 222.59 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | 3-(3-chlorophenyl)-1,1,1-trifluoropropan-2-one |
| SMILES | O=C(Cc1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C9H6ClF3O/c10-7-3-1-2-6(4-7)5-8(14)9(11,12)13/h1-4H,5H2 |
| InChIKey | AOVHCMRAEYZKQT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |