C12H15ClO — CID 59128725
1-(3-chlorophenyl)-3,3-dimethylbutan-2-one (PubChem CID 59128725) has the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3,3-dimethylbutan-2-one.
| Compound Name | 1-(3-chlorophenyl)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 59128725 |
| Molecular Formula | C12H15ClO |
| Molecular Weight | 210.70 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-(3-chlorophenyl)-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H15ClO/c1-12(2,3)11(14)8-9-5-4-6-10(13)7-9/h4-7H,8H2,1-3H3 |
| InChIKey | GNVHORKXGDUXKE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.70 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |