C14H19BrClNO — CID 106143575
N-(4-bromo-2,2-dimethylbutyl)-2-(3-chlorophenyl)acetamide (PubChem CID 106143575) has the molecular formula C14H19BrClNO and a molecular weight of 332.67 g/mol. Its IUPAC name is N-(4-bromo-2,2-dimethylbutyl)-2-(3-chlorophenyl)acetamide.
| Compound Name | N-(4-bromo-2,2-dimethylbutyl)-2-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 106143575 |
| Molecular Formula | C14H19BrClNO |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | N-(4-bromo-2,2-dimethylbutyl)-2-(3-chlorophenyl)acetamide |
| SMILES | CC(C)(CCBr)CNC(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H19BrClNO/c1-14(2,6-7-15)10-17-13(18)9-11-4-3-5-12(16)8-11/h3-5,8H,6-7,9-10H2,1-2H3,(H,17,18) |
| InChIKey | MWPHQFYNIGREMI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|