C15H23NO2 — CID 103772365
N-(4-hydroxy-2,2-dimethylbutyl)-2-(3-methylphenyl)acetamide (PubChem CID 103772365) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylbutyl)-2-(3-methylphenyl)acetamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylbutyl)-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 103772365 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylbutyl)-2-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(CC(=O)NCC(C)(C)CCO)c1 |
| InChI | InChI=1S/C15H23NO2/c1-12-5-4-6-13(9-12)10-14(18)16-11-15(2,3)7-8-17/h4-6,9,17H,7-8,10-11H2,1-3H3,(H,16,18) |
| InChIKey | FNIVNAKMNWTHEU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |