C15H20ClNO3 — CID 65261502
3-[[2-(3-chlorophenyl)acetyl]amino]-2,2,3-trimethylbutanoic acid (PubChem CID 65261502) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is 3-[[2-(3-chlorophenyl)acetyl]amino]-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-[[2-(3-chlorophenyl)acetyl]amino]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 65261502 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-[[2-(3-chlorophenyl)acetyl]amino]-2,2,3-trimethylbutanoic acid |
| SMILES | CC(C)(NC(=O)Cc1cccc(Cl)c1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C15H20ClNO3/c1-14(2,13(19)20)15(3,4)17-12(18)9-10-6-5-7-11(16)8-10/h5-8H,9H2,1-4H3,(H,17,18)(H,19,20) |
| InChIKey | IZBVLIGDWLCODJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |