C21H20ClNO — CID 15590855
2-(3-chlorophenyl)-N-(2-naphthalen-2-ylpropan-2-yl)acetamide (PubChem CID 15590855) has the molecular formula C21H20ClNO and a molecular weight of 337.85 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-(2-naphthalen-2-ylpropan-2-yl)acetamide.
| Compound Name | 2-(3-chlorophenyl)-N-(2-naphthalen-2-ylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 15590855 |
| Molecular Formula | C21H20ClNO |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-(3-chlorophenyl)-N-(2-naphthalen-2-ylpropan-2-yl)acetamide |
| SMILES | CC(C)(NC(=O)Cc1cccc(Cl)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H20ClNO/c1-21(2,18-11-10-16-7-3-4-8-17(16)14-18)23-20(24)13-15-6-5-9-19(22)12-15/h3-12,14H,13H2,1-2H3,(H,23,24) |
| InChIKey | WYOZJEQQXPEMRS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |