C10H8ClF3O2 — CID 91482736
2-(3-chlorophenyl)ethyl 2,2,2-trifluoroacetate (PubChem CID 91482736) has the molecular formula C10H8ClF3O2 and a molecular weight of 252.62 g/mol. Its IUPAC name is 2-(3-chlorophenyl)ethyl 2,2,2-trifluoroacetate.
| Compound Name | 2-(3-chlorophenyl)ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91482736 |
| Molecular Formula | C10H8ClF3O2 |
| Molecular Weight | 252.62 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 2-(3-chlorophenyl)ethyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OCCc1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C10H8ClF3O2/c11-8-3-1-2-7(6-8)4-5-16-9(15)10(12,13)14/h1-3,6H,4-5H2 |
| InChIKey | YFEXONBKPFKOME-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.62 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |