C11H9Cl2F4NO — CID 103731937
N-[2-(2,4-dichlorophenyl)ethyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103731937) has the molecular formula C11H9Cl2F4NO and a molecular weight of 318.10 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103731937 |
| Molecular Formula | C11H9Cl2F4NO |
| Molecular Weight | 318.10 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H9Cl2F4NO/c12-7-2-1-6(8(13)5-7)3-4-18-10(19)11(16,17)9(14)15/h1-2,5,9H,3-4H2,(H,18,19) |
| InChIKey | NQGMJCHHFWVOII-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.10 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|