C12H13F4NO — CID 113250799
2,2,3,3-tetrafluoro-N-[2-(2-methylphenyl)ethyl]propanamide (PubChem CID 113250799) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[2-(2-methylphenyl)ethyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[2-(2-methylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 113250799 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[2-(2-methylphenyl)ethyl]propanamide |
| SMILES | Cc1ccccc1CCNC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H13F4NO/c1-8-4-2-3-5-9(8)6-7-17-11(18)12(15,16)10(13)14/h2-5,10H,6-7H2,1H3,(H,17,18) |
| InChIKey | SNIYSKTVZXCPIX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|