C18H21BrN2O — CID 52797116
1-[2-(2-bromophenyl)ethyl]-3-[2-(2-methylphenyl)ethyl]urea (PubChem CID 52797116) has the molecular formula C18H21BrN2O and a molecular weight of 361.28 g/mol. Its IUPAC name is 1-[2-(2-bromophenyl)ethyl]-3-[2-(2-methylphenyl)ethyl]urea.
| Compound Name | 1-[2-(2-bromophenyl)ethyl]-3-[2-(2-methylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 52797116 |
| Molecular Formula | C18H21BrN2O |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 1-[2-(2-bromophenyl)ethyl]-3-[2-(2-methylphenyl)ethyl]urea |
| SMILES | Cc1ccccc1CCNC(=O)NCCc1ccccc1Br |
| InChI | InChI=1S/C18H21BrN2O/c1-14-6-2-3-7-15(14)10-12-20-18(22)21-13-11-16-8-4-5-9-17(16)19/h2-9H,10-13H2,1H3,(H2,20,21,22) |
| InChIKey | WCQSOASBNXYVMC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |