C16H16BrClN2O — CID 108900542
1-[2-(2-bromophenyl)ethyl]-3-(4-chloro-2-methylphenyl)urea (PubChem CID 108900542) has the molecular formula C16H16BrClN2O and a molecular weight of 367.67 g/mol. Its IUPAC name is 1-[2-(2-bromophenyl)ethyl]-3-(4-chloro-2-methylphenyl)urea.
| Compound Name | 1-[2-(2-bromophenyl)ethyl]-3-(4-chloro-2-methylphenyl)urea |
|---|---|
| PubChem CID | 108900542 |
| Molecular Formula | C16H16BrClN2O |
| Molecular Weight | 367.67 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 1-[2-(2-bromophenyl)ethyl]-3-(4-chloro-2-methylphenyl)urea |
| SMILES | Cc1cc(Cl)ccc1NC(=O)NCCc1ccccc1Br |
| InChI | InChI=1S/C16H16BrClN2O/c1-11-10-13(18)6-7-15(11)20-16(21)19-9-8-12-4-2-3-5-14(12)17/h2-7,10H,8-9H2,1H3,(H2,19,20,21) |
| InChIKey | HFLYQGGNCDMNIQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.67 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |