2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid

C12H14Cl2N2O3 — CID 61183611

IUPAC2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid
SMILESCC(NC(=O)NCCc1ccc(Cl)cc1Cl)C(=O)O
InChIInChI=1S/C12H14Cl2N2O3/c1-7(11(17)18)16-12(19)15-5-4-8-2-3-9(13)6-10(8)14/h2-3,6-7H,4-5H2,1H3,(H,17,18)(H2,15,16,19)
InChIKeyWUOZIWUDHROEBV-UHFFFAOYSA-N
MW305.16 g/mol
LogP2.31
Rot. Bonds5

About 2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid

2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid (PubChem CID 61183611) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid.

Molecular Properties

Compound Name2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid
PubChem CID61183611
Molecular FormulaC12H14Cl2N2O3
Molecular Weight305.16 g/mol
Exact Mass304.04
IUPAC Name2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid
SMILESCC(NC(=O)NCCc1ccc(Cl)cc1Cl)C(=O)O
InChIInChI=1S/C12H14Cl2N2O3/c1-7(11(17)18)16-12(19)15-5-4-8-2-3-9(13)6-10(8)14/h2-3,6-7H,4-5H2,1H3,(H,17,18)(H2,15,16,19)
InChIKeyWUOZIWUDHROEBV-UHFFFAOYSA-N
XLogP2.31
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.16
LogP ≤ 52.31
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid?
The IUPAC name of 2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid (CID 61183611) is 2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid.
What is the SMILES notation for 2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid?
The canonical SMILES for 2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid is CC(NC(=O)NCCc1ccc(Cl)cc1Cl)C(=O)O.
What is the InChIKey of 2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid?
The InChIKey is WUOZIWUDHROEBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2N2O3/c1-7(11(17)18)16-12(19)15-5-4-8-2-3-9(13)6-10(8)14/h2-3,6-7H,4-5H2,1H3,(H,17,18)(H2,15,16,19).
What are the key properties of 2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid?
2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid has a molecular weight of 305.16 g/mol, XLogP of 2.31, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid is sourced from PubChem (CID 61183611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).