C12H15FN2O3 — CID 3657012
2-[2-(2-fluorophenyl)ethylcarbamoylamino]propanoic acid (PubChem CID 3657012) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is 2-[2-(2-fluorophenyl)ethylcarbamoylamino]propanoic acid.
| Compound Name | 2-[2-(2-fluorophenyl)ethylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 3657012 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-[2-(2-fluorophenyl)ethylcarbamoylamino]propanoic acid |
| SMILES | CC(NC(=O)NCCc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C12H15FN2O3/c1-8(11(16)17)15-12(18)14-7-6-9-4-2-3-5-10(9)13/h2-5,8H,6-7H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | JKYHUIFBKZGCIG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |