C17H21FN2O2 — CID 60597967
1-[1-(2,5-dimethylfuran-3-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]urea (PubChem CID 60597967) has the molecular formula C17H21FN2O2 and a molecular weight of 304.36 g/mol. Its IUPAC name is 1-[1-(2,5-dimethylfuran-3-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]urea.
| Compound Name | 1-[1-(2,5-dimethylfuran-3-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 60597967 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1-[1-(2,5-dimethylfuran-3-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]urea |
| SMILES | Cc1cc(C(C)NC(=O)NCCc2ccccc2F)c(C)o1 |
| InChI | InChI=1S/C17H21FN2O2/c1-11-10-15(13(3)22-11)12(2)20-17(21)19-9-8-14-6-4-5-7-16(14)18/h4-7,10,12H,8-9H2,1-3H3,(H2,19,20,21) |
| InChIKey | MGGODIDPSXTCRF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |