C19H26N2O3 — CID 111454908
1-[1-(2,5-dimethylfuran-3-yl)ethyl]-3-(4-hydroxy-2-phenylbutyl)urea (PubChem CID 111454908) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-[1-(2,5-dimethylfuran-3-yl)ethyl]-3-(4-hydroxy-2-phenylbutyl)urea.
| Compound Name | 1-[1-(2,5-dimethylfuran-3-yl)ethyl]-3-(4-hydroxy-2-phenylbutyl)urea |
|---|---|
| PubChem CID | 111454908 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-[1-(2,5-dimethylfuran-3-yl)ethyl]-3-(4-hydroxy-2-phenylbutyl)urea |
| SMILES | Cc1cc(C(C)NC(=O)NCC(CCO)c2ccccc2)c(C)o1 |
| InChI | InChI=1S/C19H26N2O3/c1-13-11-18(15(3)24-13)14(2)21-19(23)20-12-17(9-10-22)16-7-5-4-6-8-16/h4-8,11,14,17,22H,9-10,12H2,1-3H3,(H2,20,21,23) |
| InChIKey | SWQUZVOKQYFQSQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |