C18H24N2O3 — CID 111450680
1-[(2,5-dimethylfuran-3-yl)methyl]-3-(4-hydroxy-2-phenylbutyl)urea (PubChem CID 111450680) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[(2,5-dimethylfuran-3-yl)methyl]-3-(4-hydroxy-2-phenylbutyl)urea.
| Compound Name | 1-[(2,5-dimethylfuran-3-yl)methyl]-3-(4-hydroxy-2-phenylbutyl)urea |
|---|---|
| PubChem CID | 111450680 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-[(2,5-dimethylfuran-3-yl)methyl]-3-(4-hydroxy-2-phenylbutyl)urea |
| SMILES | Cc1cc(CNC(=O)NCC(CCO)c2ccccc2)c(C)o1 |
| InChI | InChI=1S/C18H24N2O3/c1-13-10-17(14(2)23-13)12-20-18(22)19-11-16(8-9-21)15-6-4-3-5-7-15/h3-7,10,16,21H,8-9,11-12H2,1-2H3,(H2,19,20,22) |
| InChIKey | FPRZYTNRKKSBSI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |