C19H24N2O2 — CID 111452788
1-(2,6-dimethylphenyl)-3-(4-hydroxy-2-phenylbutyl)urea (PubChem CID 111452788) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-(4-hydroxy-2-phenylbutyl)urea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-(4-hydroxy-2-phenylbutyl)urea |
|---|---|
| PubChem CID | 111452788 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-(4-hydroxy-2-phenylbutyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)NCC(CCO)c1ccccc1 |
| InChI | InChI=1S/C19H24N2O2/c1-14-7-6-8-15(2)18(14)21-19(23)20-13-17(11-12-22)16-9-4-3-5-10-16/h3-10,17,22H,11-13H2,1-2H3,(H2,20,21,23) |
| InChIKey | AGNPTEIABJJFRE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |