C17H18F2N2O2 — CID 111452641
1-(2,5-difluorophenyl)-3-(4-hydroxy-2-phenylbutyl)urea (PubChem CID 111452641) has the molecular formula C17H18F2N2O2 and a molecular weight of 320.34 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-(4-hydroxy-2-phenylbutyl)urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-(4-hydroxy-2-phenylbutyl)urea |
|---|---|
| PubChem CID | 111452641 |
| Molecular Formula | C17H18F2N2O2 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-(4-hydroxy-2-phenylbutyl)urea |
| SMILES | O=C(NCC(CCO)c1ccccc1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C17H18F2N2O2/c18-14-6-7-15(19)16(10-14)21-17(23)20-11-13(8-9-22)12-4-2-1-3-5-12/h1-7,10,13,22H,8-9,11H2,(H2,20,21,23) |
| InChIKey | FCFAHRYRTXVYCG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |