C18H18F2N2O3 — CID 111456276
N'-(2,3-difluorophenyl)-N-(4-hydroxy-2-phenylbutyl)oxamide (PubChem CID 111456276) has the molecular formula C18H18F2N2O3 and a molecular weight of 348.35 g/mol. Its IUPAC name is N'-(2,3-difluorophenyl)-N-(4-hydroxy-2-phenylbutyl)oxamide.
| Compound Name | N'-(2,3-difluorophenyl)-N-(4-hydroxy-2-phenylbutyl)oxamide |
|---|---|
| PubChem CID | 111456276 |
| Molecular Formula | C18H18F2N2O3 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N'-(2,3-difluorophenyl)-N-(4-hydroxy-2-phenylbutyl)oxamide |
| SMILES | O=C(NCC(CCO)c1ccccc1)C(=O)Nc1cccc(F)c1F |
| InChI | InChI=1S/C18H18F2N2O3/c19-14-7-4-8-15(16(14)20)22-18(25)17(24)21-11-13(9-10-23)12-5-2-1-3-6-12/h1-8,13,23H,9-11H2,(H,21,24)(H,22,25) |
| InChIKey | KCBZXGIRNLZTMN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|