C14H12F2N2O — CID 61077017
2-amino-N-(2,3-difluorophenyl)-2-phenylacetamide (PubChem CID 61077017) has the molecular formula C14H12F2N2O and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-amino-N-(2,3-difluorophenyl)-2-phenylacetamide.
| Compound Name | 2-amino-N-(2,3-difluorophenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 61077017 |
| Molecular Formula | C14H12F2N2O |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-amino-N-(2,3-difluorophenyl)-2-phenylacetamide |
| SMILES | NC(C(=O)Nc1cccc(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C14H12F2N2O/c15-10-7-4-8-11(12(10)16)18-14(19)13(17)9-5-2-1-3-6-9/h1-8,13H,17H2,(H,18,19) |
| InChIKey | VSADJHHSUGSVLI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |