C7H7F2N3O — CID 61075420
1-amino-3-(2,3-difluorophenyl)urea (PubChem CID 61075420) has the molecular formula C7H7F2N3O and a molecular weight of 187.15 g/mol. Its IUPAC name is 1-amino-3-(2,3-difluorophenyl)urea.
| Compound Name | 1-amino-3-(2,3-difluorophenyl)urea |
|---|---|
| PubChem CID | 61075420 |
| Molecular Formula | C7H7F2N3O |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 1-amino-3-(2,3-difluorophenyl)urea |
| SMILES | NNC(=O)Nc1cccc(F)c1F |
| InChI | InChI=1S/C7H7F2N3O/c8-4-2-1-3-5(6(4)9)11-7(13)12-10/h1-3H,10H2,(H2,11,12,13) |
| InChIKey | WMBOSDCMIJZTRF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|