C11H13F2N3O2 — CID 86856275
2-[(2,3-difluorophenyl)carbamoylamino]-N-ethylacetamide (PubChem CID 86856275) has the molecular formula C11H13F2N3O2 and a molecular weight of 257.24 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)carbamoylamino]-N-ethylacetamide.
| Compound Name | 2-[(2,3-difluorophenyl)carbamoylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 86856275 |
| Molecular Formula | C11H13F2N3O2 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-[(2,3-difluorophenyl)carbamoylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNC(=O)Nc1cccc(F)c1F |
| InChI | InChI=1S/C11H13F2N3O2/c1-2-14-9(17)6-15-11(18)16-8-5-3-4-7(12)10(8)13/h3-5H,2,6H2,1H3,(H,14,17)(H2,15,16,18) |
| InChIKey | QJZOISYSXKNCEP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |