C10H10F2N2O4 — CID 66167999
3-[(2,3-difluorophenyl)carbamoylamino]-2-hydroxypropanoic acid (PubChem CID 66167999) has the molecular formula C10H10F2N2O4 and a molecular weight of 260.20 g/mol. Its IUPAC name is 3-[(2,3-difluorophenyl)carbamoylamino]-2-hydroxypropanoic acid.
| Compound Name | 3-[(2,3-difluorophenyl)carbamoylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 66167999 |
| Molecular Formula | C10H10F2N2O4 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 3-[(2,3-difluorophenyl)carbamoylamino]-2-hydroxypropanoic acid |
| SMILES | O=C(NCC(O)C(=O)O)Nc1cccc(F)c1F |
| InChI | InChI=1S/C10H10F2N2O4/c11-5-2-1-3-6(8(5)12)14-10(18)13-4-7(15)9(16)17/h1-3,7,15H,4H2,(H,16,17)(H2,13,14,18) |
| InChIKey | IPQWVJVKQAPTCI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |