C14H20F2N2O3 — CID 111103722
1-(2,3-difluorophenyl)-3-[2-hydroxy-3-(2-methylpropoxy)propyl]urea (PubChem CID 111103722) has the molecular formula C14H20F2N2O3 and a molecular weight of 302.32 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-3-[2-hydroxy-3-(2-methylpropoxy)propyl]urea.
| Compound Name | 1-(2,3-difluorophenyl)-3-[2-hydroxy-3-(2-methylpropoxy)propyl]urea |
|---|---|
| PubChem CID | 111103722 |
| Molecular Formula | C14H20F2N2O3 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-(2,3-difluorophenyl)-3-[2-hydroxy-3-(2-methylpropoxy)propyl]urea |
| SMILES | CC(C)COCC(O)CNC(=O)Nc1cccc(F)c1F |
| InChI | InChI=1S/C14H20F2N2O3/c1-9(2)7-21-8-10(19)6-17-14(20)18-12-5-3-4-11(15)13(12)16/h3-5,9-10,19H,6-8H2,1-2H3,(H2,17,18,20) |
| InChIKey | XKELSKPFZHGSJV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |