C11H13F2NO2 — CID 79193547
N-(2,3-difluorophenyl)-4-hydroxypentanamide (PubChem CID 79193547) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-4-hydroxypentanamide.
| Compound Name | N-(2,3-difluorophenyl)-4-hydroxypentanamide |
|---|---|
| PubChem CID | 79193547 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-(2,3-difluorophenyl)-4-hydroxypentanamide |
| SMILES | CC(O)CCC(=O)Nc1cccc(F)c1F |
| InChI | InChI=1S/C11H13F2NO2/c1-7(15)5-6-10(16)14-9-4-2-3-8(12)11(9)13/h2-4,7,15H,5-6H2,1H3,(H,14,16) |
| InChIKey | RHYSSXNQHBXGIT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |