C9H9F2N3O3 — CID 69121080
[[2-(2,3-difluoroanilino)-2-oxoethyl]amino]carbamic acid (PubChem CID 69121080) has the molecular formula C9H9F2N3O3 and a molecular weight of 245.18 g/mol. Its IUPAC name is [[2-(2,3-difluoroanilino)-2-oxoethyl]amino]carbamic acid.
| Compound Name | [[2-(2,3-difluoroanilino)-2-oxoethyl]amino]carbamic acid |
|---|---|
| PubChem CID | 69121080 |
| Molecular Formula | C9H9F2N3O3 |
| Molecular Weight | 245.18 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | [[2-(2,3-difluoroanilino)-2-oxoethyl]amino]carbamic acid |
| SMILES | O=C(O)NNCC(=O)Nc1cccc(F)c1F |
| InChI | InChI=1S/C9H9F2N3O3/c10-5-2-1-3-6(8(5)11)13-7(15)4-12-14-9(16)17/h1-3,12,14H,4H2,(H,13,15)(H,16,17) |
| InChIKey | YDRYDRSHPXYUEA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.18 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|