C10H11FN2O3 — CID 43466135
2-[[2-(2-fluoroanilino)-2-oxoethyl]amino]acetic acid (PubChem CID 43466135) has the molecular formula C10H11FN2O3 and a molecular weight of 226.21 g/mol. Its IUPAC name is 2-[[2-(2-fluoroanilino)-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[[2-(2-fluoroanilino)-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 43466135 |
| Molecular Formula | C10H11FN2O3 |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-[[2-(2-fluoroanilino)-2-oxoethyl]amino]acetic acid |
| SMILES | O=C(O)CNCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C10H11FN2O3/c11-7-3-1-2-4-8(7)13-9(14)5-12-6-10(15)16/h1-4,12H,5-6H2,(H,13,14)(H,15,16) |
| InChIKey | FIDTXHUXKLZJTO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |