C14H21IN2O3 — CID 87007219
1-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-(2-iodophenyl)urea (PubChem CID 87007219) has the molecular formula C14H21IN2O3 and a molecular weight of 392.24 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-(2-iodophenyl)urea.
| Compound Name | 1-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-(2-iodophenyl)urea |
|---|---|
| PubChem CID | 87007219 |
| Molecular Formula | C14H21IN2O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 1-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-(2-iodophenyl)urea |
| SMILES | CC(C)COCC(O)CNC(=O)Nc1ccccc1I |
| InChI | InChI=1S/C14H21IN2O3/c1-10(2)8-20-9-11(18)7-16-14(19)17-13-6-4-3-5-12(13)15/h3-6,10-11,18H,7-9H2,1-2H3,(H2,16,17,19) |
| InChIKey | ZTLBOHHRWJRUOE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|