C10H9Cl2FN2O4 — CID 107841588
(2S)-3-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]-2-hydroxypropanoic acid (PubChem CID 107841588) has the molecular formula C10H9Cl2FN2O4 and a molecular weight of 311.10 g/mol. Its IUPAC name is (2S)-3-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 107841588 |
| Molecular Formula | C10H9Cl2FN2O4 |
| Molecular Weight | 311.10 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | (2S)-3-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]-2-hydroxypropanoic acid |
| SMILES | O=C(NC[C@H](O)C(=O)O)Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2FN2O4/c11-5-1-4(2-6(12)8(5)13)15-10(19)14-3-7(16)9(17)18/h1-2,7,16H,3H2,(H,17,18)(H2,14,15,19)/t7-/m0/s1 |
| InChIKey | IJGQAOJNFLMFLH-ZETCQYMHSA-N |
| XLogP | 1.70 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.10 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|