C11H10Cl2FN3O4 — CID 107576471
2-[[2-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]acetyl]amino]acetic acid (PubChem CID 107576471) has the molecular formula C11H10Cl2FN3O4 and a molecular weight of 338.12 g/mol. Its IUPAC name is 2-[[2-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 107576471 |
| Molecular Formula | C11H10Cl2FN3O4 |
| Molecular Weight | 338.12 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 2-[[2-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNC(=O)Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C11H10Cl2FN3O4/c12-6-1-5(2-7(13)10(6)14)17-11(21)16-3-8(18)15-4-9(19)20/h1-2H,3-4H2,(H,15,18)(H,19,20)(H2,16,17,21) |
| InChIKey | MHGQFUFGCXCFRC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.12 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|