C21H26N2O4 — CID 100723369
N-[(2S)-4-hydroxy-2-phenylbutyl]-N'-[3-(2-hydroxypropan-2-yl)phenyl]oxamide (PubChem CID 100723369) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[(2S)-4-hydroxy-2-phenylbutyl]-N'-[3-(2-hydroxypropan-2-yl)phenyl]oxamide.
| Compound Name | N-[(2S)-4-hydroxy-2-phenylbutyl]-N'-[3-(2-hydroxypropan-2-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 100723369 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-[(2S)-4-hydroxy-2-phenylbutyl]-N'-[3-(2-hydroxypropan-2-yl)phenyl]oxamide |
| SMILES | CC(C)(O)c1cccc(NC(=O)C(=O)NCC(CCO)c2ccccc2)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-21(2,27)17-9-6-10-18(13-17)23-20(26)19(25)22-14-16(11-12-24)15-7-4-3-5-8-15/h3-10,13,16,24,27H,11-12,14H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | NJEGERMYYKHINL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|