C18H20N2O3 — CID 121112034
N-(2-hydroxy-2-phenylpropyl)-N'-(3-methylphenyl)oxamide (PubChem CID 121112034) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-(2-hydroxy-2-phenylpropyl)-N'-(3-methylphenyl)oxamide.
| Compound Name | N-(2-hydroxy-2-phenylpropyl)-N'-(3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 121112034 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-(2-hydroxy-2-phenylpropyl)-N'-(3-methylphenyl)oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)NCC(C)(O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H20N2O3/c1-13-7-6-10-15(11-13)20-17(22)16(21)19-12-18(2,23)14-8-4-3-5-9-14/h3-11,23H,12H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | XRMCPDIMXFVYEA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|