C23H20F2N2O3 — CID 90497618
N'-(3,4-difluorophenyl)-N-[2-hydroxy-2-(4-phenylphenyl)propyl]oxamide (PubChem CID 90497618) has the molecular formula C23H20F2N2O3 and a molecular weight of 410.42 g/mol. Its IUPAC name is N'-(3,4-difluorophenyl)-N-[2-hydroxy-2-(4-phenylphenyl)propyl]oxamide.
| Compound Name | N'-(3,4-difluorophenyl)-N-[2-hydroxy-2-(4-phenylphenyl)propyl]oxamide |
|---|---|
| PubChem CID | 90497618 |
| Molecular Formula | C23H20F2N2O3 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N'-(3,4-difluorophenyl)-N-[2-hydroxy-2-(4-phenylphenyl)propyl]oxamide |
| SMILES | CC(O)(CNC(=O)C(=O)Nc1ccc(F)c(F)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20F2N2O3/c1-23(30,17-9-7-16(8-10-17)15-5-3-2-4-6-15)14-26-21(28)22(29)27-18-11-12-19(24)20(25)13-18/h2-13,30H,14H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | FIOMOZITASOESY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|