C22H18F2N2O2 — CID 86856671
N-(2,3-difluorophenyl)-N'-[(4-methylphenyl)-phenylmethyl]oxamide (PubChem CID 86856671) has the molecular formula C22H18F2N2O2 and a molecular weight of 380.39 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-N'-[(4-methylphenyl)-phenylmethyl]oxamide.
| Compound Name | N-(2,3-difluorophenyl)-N'-[(4-methylphenyl)-phenylmethyl]oxamide |
|---|---|
| PubChem CID | 86856671 |
| Molecular Formula | C22H18F2N2O2 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-(2,3-difluorophenyl)-N'-[(4-methylphenyl)-phenylmethyl]oxamide |
| SMILES | Cc1ccc(C(NC(=O)C(=O)Nc2cccc(F)c2F)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18F2N2O2/c1-14-10-12-16(13-11-14)20(15-6-3-2-4-7-15)26-22(28)21(27)25-18-9-5-8-17(23)19(18)24/h2-13,20H,1H3,(H,25,27)(H,26,28) |
| InChIKey | YPOIADLZLHYBMJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|