C20H16ClFN2O — CID 45352104
1-[(4-chlorophenyl)-phenylmethyl]-3-(2-fluorophenyl)urea (PubChem CID 45352104) has the molecular formula C20H16ClFN2O and a molecular weight of 354.81 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-phenylmethyl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[(4-chlorophenyl)-phenylmethyl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 45352104 |
| Molecular Formula | C20H16ClFN2O |
| Molecular Weight | 354.81 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-[(4-chlorophenyl)-phenylmethyl]-3-(2-fluorophenyl)urea |
| SMILES | O=C(Nc1ccccc1F)NC(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H16ClFN2O/c21-16-12-10-15(11-13-16)19(14-6-2-1-3-7-14)24-20(25)23-18-9-5-4-8-17(18)22/h1-13,19H,(H2,23,24,25) |
| InChIKey | WHALENUBLVVXEH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.81 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |