C28H22ClFN2O2 — CID 5184696
N-[2-(benzhydrylamino)-1-(4-chlorophenyl)-2-oxoethyl]-2-fluorobenzamide (PubChem CID 5184696) has the molecular formula C28H22ClFN2O2 and a molecular weight of 472.95 g/mol. Its IUPAC name is N-[2-(benzhydrylamino)-1-(4-chlorophenyl)-2-oxoethyl]-2-fluorobenzamide.
| Compound Name | N-[2-(benzhydrylamino)-1-(4-chlorophenyl)-2-oxoethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 5184696 |
| Molecular Formula | C28H22ClFN2O2 |
| Molecular Weight | 472.95 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-[2-(benzhydrylamino)-1-(4-chlorophenyl)-2-oxoethyl]-2-fluorobenzamide |
| SMILES | O=C(NC(C(=O)NC(c1ccccc1)c1ccccc1)c1ccc(Cl)cc1)c1ccccc1F |
| InChI | InChI=1S/C28H22ClFN2O2/c29-22-17-15-21(16-18-22)26(32-27(33)23-13-7-8-14-24(23)30)28(34)31-25(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-18,25-26H,(H,31,34)(H,32,33) |
| InChIKey | IWQMICZNFNMMSX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.95 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |