C19H20F2N2O2 — CID 146132621
N-(2,3-difluorophenyl)-N'-methyl-N'-[1-(4-methylphenyl)propan-2-yl]oxamide (PubChem CID 146132621) has the molecular formula C19H20F2N2O2 and a molecular weight of 346.38 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-N'-methyl-N'-[1-(4-methylphenyl)propan-2-yl]oxamide.
| Compound Name | N-(2,3-difluorophenyl)-N'-methyl-N'-[1-(4-methylphenyl)propan-2-yl]oxamide |
|---|---|
| PubChem CID | 146132621 |
| Molecular Formula | C19H20F2N2O2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-(2,3-difluorophenyl)-N'-methyl-N'-[1-(4-methylphenyl)propan-2-yl]oxamide |
| SMILES | Cc1ccc(CC(C)N(C)C(=O)C(=O)Nc2cccc(F)c2F)cc1 |
| InChI | InChI=1S/C19H20F2N2O2/c1-12-7-9-14(10-8-12)11-13(2)23(3)19(25)18(24)22-16-6-4-5-15(20)17(16)21/h4-10,13H,11H2,1-3H3,(H,22,24) |
| InChIKey | CWQVNMSZMVMISA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|